Filtered Search Results
Potassium methanesulfonate, 99%
CAS: 2386-56-3 Molecular Formula: CH3KO3S Molecular Weight (g/mol): 134.19 MDL Number: MFCD00070544 InChI Key: XWIJIXWOZCRYEL-UHFFFAOYSA-M Synonym: potassium methanesulfonate,methanesulfonic acid, potassium salt,potassium mesylate,potassium methylsulfonate,potassium methyl sulfonate,potassium methanesulphonate,unii-s99ib3em17,methanesulfonic acid potassium salt,methanesulfonic acid,potassium salt 1:1,methanesulfonic acid, potassium salt 1:1 PubChem CID: 23666501 IUPAC Name: potassium;methanesulfonate SMILES: CS(=O)(=O)[O-].[K+]
| PubChem CID | 23666501 |
|---|---|
| CAS | 2386-56-3 |
| Molecular Weight (g/mol) | 134.19 |
| MDL Number | MFCD00070544 |
| SMILES | CS(=O)(=O)[O-].[K+] |
| Synonym | potassium methanesulfonate,methanesulfonic acid, potassium salt,potassium mesylate,potassium methylsulfonate,potassium methyl sulfonate,potassium methanesulphonate,unii-s99ib3em17,methanesulfonic acid potassium salt,methanesulfonic acid,potassium salt 1:1,methanesulfonic acid, potassium salt 1:1 |
| IUPAC Name | potassium;methanesulfonate |
| InChI Key | XWIJIXWOZCRYEL-UHFFFAOYSA-M |
| Molecular Formula | CH3KO3S |
Aluminum acetate, basic hydrate
CAS: 142-03-0 Molecular Formula: C4H7AlO5 Molecular Weight (g/mol): 162.08 MDL Number: MFCD00008688 InChI Key: HQQUTGFAWJNQIP-UHFFFAOYSA-K Synonym: aluminum acetate, basic hydrate,c4h7alo5.h2o,aluminum diacetate hydrate PubChem CID: 18502856 SMILES: CC(=O)O[Al](O)OC(C)=O
| PubChem CID | 18502856 |
|---|---|
| CAS | 142-03-0 |
| Molecular Weight (g/mol) | 162.08 |
| MDL Number | MFCD00008688 |
| SMILES | CC(=O)O[Al](O)OC(C)=O |
| Synonym | aluminum acetate, basic hydrate,c4h7alo5.h2o,aluminum diacetate hydrate |
| InChI Key | HQQUTGFAWJNQIP-UHFFFAOYSA-K |
| Molecular Formula | C4H7AlO5 |
Ethylenediaminetetraacetic acid, iron(III) monosodium salt
CAS: 15708-41-5 Molecular Formula: C10H12FeN2NaO8 Molecular Weight (g/mol): 367.047 MDL Number: MFCD00078215 InChI Key: MKWYFZFMAMBPQK-UHFFFAOYSA-J Synonym: sodium feredetate,edta ferric sodium salt,calmosine,sodium ironedetate,edta iron iii sodium salt,ferisan,sytron,sequestrene nafe,sodium iron edta,ferric sodium edta PubChem CID: 27461 ChEBI: CHEBI:78292 IUPAC Name: sodium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;iron(3+) SMILES: C(CN(CC(=O)[O-])CC(=O)[O-])N(CC(=O)[O-])CC(=O)[O-].[Na+].[Fe+3]
| PubChem CID | 27461 |
|---|---|
| CAS | 15708-41-5 |
| Molecular Weight (g/mol) | 367.047 |
| ChEBI | CHEBI:78292 |
| MDL Number | MFCD00078215 |
| SMILES | C(CN(CC(=O)[O-])CC(=O)[O-])N(CC(=O)[O-])CC(=O)[O-].[Na+].[Fe+3] |
| Synonym | sodium feredetate,edta ferric sodium salt,calmosine,sodium ironedetate,edta iron iii sodium salt,ferisan,sytron,sequestrene nafe,sodium iron edta,ferric sodium edta |
| IUPAC Name | sodium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxylatomethyl)amino]acetate;iron(3+) |
| InChI Key | MKWYFZFMAMBPQK-UHFFFAOYSA-J |
| Molecular Formula | C10H12FeN2NaO8 |
Tin(II) 2-ethylhexanoate, 95%
CAS: 301-10-0 Molecular Formula: C16H30O4Sn Molecular Weight (g/mol): 405.122 MDL Number: MFCD00002676 InChI Key: KSBAEPSJVUENNK-UHFFFAOYSA-L Synonym: stannous octoate,tin ii 2-ethylhexanoate,tin octoate,tin ii bis 2-ethylhexanoate,tin 2+ bis 2-ethylhexanoate,tin ethylhexanoate,tin 2-ethylhexanoate,hexanoic acid, 2-ethyl-, tin 2+ salt,stannous 2-ethylhexoate,tin ii 2-ethylhexylate PubChem CID: 9318 IUPAC Name: 2-ethylhexanoate;tin(2+) SMILES: CCCCC(CC)C(=O)[O-].CCCCC(CC)C(=O)[O-].[Sn+2]
| PubChem CID | 9318 |
|---|---|
| CAS | 301-10-0 |
| Molecular Weight (g/mol) | 405.122 |
| MDL Number | MFCD00002676 |
| SMILES | CCCCC(CC)C(=O)[O-].CCCCC(CC)C(=O)[O-].[Sn+2] |
| Synonym | stannous octoate,tin ii 2-ethylhexanoate,tin octoate,tin ii bis 2-ethylhexanoate,tin 2+ bis 2-ethylhexanoate,tin ethylhexanoate,tin 2-ethylhexanoate,hexanoic acid, 2-ethyl-, tin 2+ salt,stannous 2-ethylhexoate,tin ii 2-ethylhexylate |
| IUPAC Name | 2-ethylhexanoate;tin(2+) |
| InChI Key | KSBAEPSJVUENNK-UHFFFAOYSA-L |
| Molecular Formula | C16H30O4Sn |
Tripotassium citrate monohydrate, 99+%
CAS: 6100-05-6 Molecular Formula: C6H7K3O8 Molecular Weight (g/mol): 324.41 MDL Number: MFCD00150442 InChI Key: PJAHUDTUZRZBKM-UHFFFAOYSA-K Synonym: potassium citrate monohydrate,tripotassium citrate monohydrate,unii-ee90oni6ff,ee90oni6ff,citric acid tripotassium salt,urocit-k,ccris 6543,tri-potassium citrate monohydrate,potassium citrate tribasic monohydrate,citric acid, tripotassium salt, monohydrate PubChem CID: 2735208 ChEBI: CHEBI:64746 IUPAC Name: tripotassium;2-hydroxypropane-1,2,3-tricarboxylate;hydrate SMILES: C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.O.[K+].[K+].[K+]
| PubChem CID | 2735208 |
|---|---|
| CAS | 6100-05-6 |
| Molecular Weight (g/mol) | 324.41 |
| ChEBI | CHEBI:64746 |
| MDL Number | MFCD00150442 |
| SMILES | C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.O.[K+].[K+].[K+] |
| Synonym | potassium citrate monohydrate,tripotassium citrate monohydrate,unii-ee90oni6ff,ee90oni6ff,citric acid tripotassium salt,urocit-k,ccris 6543,tri-potassium citrate monohydrate,potassium citrate tribasic monohydrate,citric acid, tripotassium salt, monohydrate |
| IUPAC Name | tripotassium;2-hydroxypropane-1,2,3-tricarboxylate;hydrate |
| InChI Key | PJAHUDTUZRZBKM-UHFFFAOYSA-K |
| Molecular Formula | C6H7K3O8 |
Sodium stearate
CAS: 822-16-2 Molecular Formula: C18H35NaO2 Molecular Weight (g/mol): 306.466 MDL Number: MFCD00036404 InChI Key: RYYKJJJTJZKILX-UHFFFAOYSA-M Synonym: sodium stearate,sodium octadecanoate,octadecanoic acid, sodium salt,stearates,stearic acid, sodium salt,prodhygine,flexichem b,stearic acid sodium salt,bonderlube 235,unii-qu7e2xa9tg PubChem CID: 2724691 IUPAC Name: sodium;octadecanoate SMILES: CCCCCCCCCCCCCCCCCC(=O)[O-].[Na+]
| PubChem CID | 2724691 |
|---|---|
| CAS | 822-16-2 |
| Molecular Weight (g/mol) | 306.466 |
| MDL Number | MFCD00036404 |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)[O-].[Na+] |
| Synonym | sodium stearate,sodium octadecanoate,octadecanoic acid, sodium salt,stearates,stearic acid, sodium salt,prodhygine,flexichem b,stearic acid sodium salt,bonderlube 235,unii-qu7e2xa9tg |
| IUPAC Name | sodium;octadecanoate |
| InChI Key | RYYKJJJTJZKILX-UHFFFAOYSA-M |
| Molecular Formula | C18H35NaO2 |
Trisodium citrate, anhydrous, 99%
CAS: 68-04-2 Molecular Formula: C6H5Na3O7 Molecular Weight (g/mol): 258.07 MDL Number: MFCD00012462 InChI Key: HRXKRNGNAMMEHJ-UHFFFAOYSA-K Synonym: sodium citrate,trisodium citrate,citrosodine,sodium citrate anhydrous,citrosodina,natrocitral,citnatin,citreme,citrosodna,trisodium citrate, anhydrous PubChem CID: 6224 ChEBI: CHEBI:53258 IUPAC Name: trisodium;2-hydroxypropane-1,2,3-tricarboxylate SMILES: [Na+].[Na+].[Na+].OC(CC([O-])=O)(CC([O-])=O)C([O-])=O
| PubChem CID | 6224 |
|---|---|
| CAS | 68-04-2 |
| Molecular Weight (g/mol) | 258.07 |
| ChEBI | CHEBI:53258 |
| MDL Number | MFCD00012462 |
| SMILES | [Na+].[Na+].[Na+].OC(CC([O-])=O)(CC([O-])=O)C([O-])=O |
| Synonym | sodium citrate,trisodium citrate,citrosodine,sodium citrate anhydrous,citrosodina,natrocitral,citnatin,citreme,citrosodna,trisodium citrate, anhydrous |
| IUPAC Name | trisodium;2-hydroxypropane-1,2,3-tricarboxylate |
| InChI Key | HRXKRNGNAMMEHJ-UHFFFAOYSA-K |
| Molecular Formula | C6H5Na3O7 |
Disodium hydrogen citrate sesquihydrate, 99%
CAS: 5-4-6132 Molecular Formula: C12H18Na4O17 Molecular Weight (g/mol): 526.22 MDL Number: MFCD00150445 InChI Key: HGPVLOQNBSHYEI-UHFFFAOYNA-J Synonym: unii-cz1032cekr,cz1032cekr,sodium citrate dibasic sesquihydrate,disodium citrate sesquihydrate,disodium hydrogen citrate 1.5 h2o,sodium hydrogen citrate sesquihydrate,citric acid, disodium salt, sesquihydrate,tetrasodium, 3-carboxy-3-hydroxypentanedioate, trihydrate,sodium citrate dibasic sesquihydrate, purum p.a t,1,2,3-propanetricarboxylic acid, 2-hydroxy-, disodium salt, hydrate 2:3 PubChem CID: 117063816 IUPAC Name: tetrasodium;2-(carboxymethyl)-2-hydroxybutanedioate;trihydrate SMILES: C(C(=O)O)C(CC(=O)[O-])(C(=O)[O-])O.C(C(=O)O)C(CC(=O)[O-])(C(=O)[O-])O.O.O.O.[Na+].[Na+].[Na+].[Na+]
| PubChem CID | 117063816 |
|---|---|
| CAS | 5-4-6132 |
| Molecular Weight (g/mol) | 526.22 |
| MDL Number | MFCD00150445 |
| SMILES | C(C(=O)O)C(CC(=O)[O-])(C(=O)[O-])O.C(C(=O)O)C(CC(=O)[O-])(C(=O)[O-])O.O.O.O.[Na+].[Na+].[Na+].[Na+] |
| Synonym | unii-cz1032cekr,cz1032cekr,sodium citrate dibasic sesquihydrate,disodium citrate sesquihydrate,disodium hydrogen citrate 1.5 h2o,sodium hydrogen citrate sesquihydrate,citric acid, disodium salt, sesquihydrate,tetrasodium, 3-carboxy-3-hydroxypentanedioate, trihydrate,sodium citrate dibasic sesquihydrate, purum p.a t,1,2,3-propanetricarboxylic acid, 2-hydroxy-, disodium salt, hydrate 2:3 |
| IUPAC Name | tetrasodium;2-(carboxymethyl)-2-hydroxybutanedioate;trihydrate |
| InChI Key | HGPVLOQNBSHYEI-UHFFFAOYNA-J |
| Molecular Formula | C12H18Na4O17 |
Iron(II) phthalocyanine, 96%
CAS: 132-16-1 Molecular Formula: C32H16FeN8 Molecular Weight (g/mol): 568.38 MDL Number: MFCD00015953 InChI Key: MIINHRNQLVVCEW-UHFFFAOYSA-N Synonym: iron phthalocyanine,iron ii phthalocyanine,ferrous phthalocyanine,phthalocyanine iron ii,fepc,29h,31h-phthalocyaninato 2--n29,n30,n31,n32 iron,iron, 29h,31h-phthalocyaninato 2--n29,n39,n31,n32-, sp-4-1,iron, 29h,31h-phthalocyaninato 2--kappan29,kappan30,kappan31,kappan32-, sp-4-1 PubChem CID: 2735065 IUPAC Name: λ²-iron(2+) 2,11,20,29,37,38,39,40-octaazanonacyclo[28.6.1.1³,¹⁰.1¹²,¹⁹.1²¹,²⁸.0⁴,⁹.0¹³,¹⁸.0²²,²⁷.0³¹,³⁶]tetraconta-1(36),2,4,6,8,10(40),11,13,15,17,19,21(38),22,24,26,28,30,32,34-nonadecaene-37,39-diide SMILES: [Fe++].[N-]1C2=NC3=NC(=NC4=C5C=CC=CC5=C([N-]4)N=C4N=C(N=C1C1=CC=CC=C21)C1=CC=CC=C41)C1=CC=CC=C31
| PubChem CID | 2735065 |
|---|---|
| CAS | 132-16-1 |
| Molecular Weight (g/mol) | 568.38 |
| MDL Number | MFCD00015953 |
| SMILES | [Fe++].[N-]1C2=NC3=NC(=NC4=C5C=CC=CC5=C([N-]4)N=C4N=C(N=C1C1=CC=CC=C21)C1=CC=CC=C41)C1=CC=CC=C31 |
| Synonym | iron phthalocyanine,iron ii phthalocyanine,ferrous phthalocyanine,phthalocyanine iron ii,fepc,29h,31h-phthalocyaninato 2--n29,n30,n31,n32 iron,iron, 29h,31h-phthalocyaninato 2--n29,n39,n31,n32-, sp-4-1,iron, 29h,31h-phthalocyaninato 2--kappan29,kappan30,kappan31,kappan32-, sp-4-1 |
| IUPAC Name | λ²-iron(2+) 2,11,20,29,37,38,39,40-octaazanonacyclo[28.6.1.1³,¹⁰.1¹²,¹⁹.1²¹,²⁸.0⁴,⁹.0¹³,¹⁸.0²²,²⁷.0³¹,³⁶]tetraconta-1(36),2,4,6,8,10(40),11,13,15,17,19,21(38),22,24,26,28,30,32,34-nonadecaene-37,39-diide |
| InChI Key | MIINHRNQLVVCEW-UHFFFAOYSA-N |
| Molecular Formula | C32H16FeN8 |
Disodium terephthalate, 99+%
CAS: 10028-70-3 Molecular Formula: C8H4Na2O4 Molecular Weight (g/mol): 210.096 MDL Number: MFCD00013137 InChI Key: VIQSRHWJEKERKR-UHFFFAOYSA-L Synonym: disodium terephthalate,terephthalic acid disodium salt,terephthalic acid, disodium salt,sodium terephthalate,unii-gi30zoc0oo,gi30zoc0oo,disodiumterephthalate,acmc-1bvw0,disodium terephthalate 5g,1,4-benzenedicarboxylicacid, sodium salt 1:? PubChem CID: 82305 IUPAC Name: disodium;terephthalate SMILES: C1=CC(=CC=C1C(=O)[O-])C(=O)[O-].[Na+].[Na+]
| PubChem CID | 82305 |
|---|---|
| CAS | 10028-70-3 |
| Molecular Weight (g/mol) | 210.096 |
| MDL Number | MFCD00013137 |
| SMILES | C1=CC(=CC=C1C(=O)[O-])C(=O)[O-].[Na+].[Na+] |
| Synonym | disodium terephthalate,terephthalic acid disodium salt,terephthalic acid, disodium salt,sodium terephthalate,unii-gi30zoc0oo,gi30zoc0oo,disodiumterephthalate,acmc-1bvw0,disodium terephthalate 5g,1,4-benzenedicarboxylicacid, sodium salt 1:? |
| IUPAC Name | disodium;terephthalate |
| InChI Key | VIQSRHWJEKERKR-UHFFFAOYSA-L |
| Molecular Formula | C8H4Na2O4 |
n-Butyllithium, 1.6M solution in hexanes, AcroSeal™
CAS: 109-72-8 Molecular Formula: C4H9Li Molecular Weight (g/mol): 64.06 MDL Number: MFCD00009414 InChI Key: MZRVEZGGRBJDDB-UHFFFAOYSA-N Synonym: n-butyllithium,lithium, butyl,butyllithium,butyl lithium,n-butyl lithium,lithium butane,n-buli,buli,libu,unii-09w9a6b8zc PubChem CID: 61028 SMILES: [Li]CCCC
| PubChem CID | 61028 |
|---|---|
| CAS | 109-72-8 |
| Molecular Weight (g/mol) | 64.06 |
| MDL Number | MFCD00009414 |
| SMILES | [Li]CCCC |
| Synonym | n-butyllithium,lithium, butyl,butyllithium,butyl lithium,n-butyl lithium,lithium butane,n-buli,buli,libu,unii-09w9a6b8zc |
| InChI Key | MZRVEZGGRBJDDB-UHFFFAOYSA-N |
| Molecular Formula | C4H9Li |
Lithium diisopropylamide, 2M sol. in THF/n-heptane/ethylbenzene, AcroSeal™
CAS: 4111-54-0 Molecular Formula: C6H14LiN Molecular Weight (g/mol): 107.125 MDL Number: MFCD00064449 InChI Key: ZCSHNCUQKCANBX-UHFFFAOYSA-N Synonym: lithium diisopropylamide,unii-ol028kiw1i,lithium di-isopropylamide,lithium diisopropyl amide,2-propanamine, n-1-methylethyl-, lithium salt,ol028kiw1i,lithium di propan-2-yl azanide,2-propanamine, n-1-methylethyl-, lithium salt 1:1,lithium n,n-diisopropylamide,ipr2nli PubChem CID: 2724682 IUPAC Name: lithium;di(propan-2-yl)azanide SMILES: [Li+].CC(C)[N-]C(C)C
| PubChem CID | 2724682 |
|---|---|
| CAS | 4111-54-0 |
| Molecular Weight (g/mol) | 107.125 |
| MDL Number | MFCD00064449 |
| SMILES | [Li+].CC(C)[N-]C(C)C |
| Synonym | lithium diisopropylamide,unii-ol028kiw1i,lithium di-isopropylamide,lithium diisopropyl amide,2-propanamine, n-1-methylethyl-, lithium salt,ol028kiw1i,lithium di propan-2-yl azanide,2-propanamine, n-1-methylethyl-, lithium salt 1:1,lithium n,n-diisopropylamide,ipr2nli |
| IUPAC Name | lithium;di(propan-2-yl)azanide |
| InChI Key | ZCSHNCUQKCANBX-UHFFFAOYSA-N |
| Molecular Formula | C6H14LiN |
n-Butyllithium, 2.5M solution in hexanes, AcroSeal™
CAS: 109-72-8 Molecular Formula: C4H9Li Molecular Weight (g/mol): 64.06 MDL Number: MFCD00009414 InChI Key: MZRVEZGGRBJDDB-UHFFFAOYSA-N Synonym: n-butyllithium,lithium, butyl,butyllithium,butyl lithium,n-butyl lithium,lithium butane,n-buli,buli,libu,unii-09w9a6b8zc PubChem CID: 61028 SMILES: [Li]CCCC
| PubChem CID | 61028 |
|---|---|
| CAS | 109-72-8 |
| Molecular Weight (g/mol) | 64.06 |
| MDL Number | MFCD00009414 |
| SMILES | [Li]CCCC |
| Synonym | n-butyllithium,lithium, butyl,butyllithium,butyl lithium,n-butyl lithium,lithium butane,n-buli,buli,libu,unii-09w9a6b8zc |
| InChI Key | MZRVEZGGRBJDDB-UHFFFAOYSA-N |
| Molecular Formula | C4H9Li |
Boron trifluoride etherate, ca. 48% BF3, AcroSeal™
CAS: 109-63-7 Molecular Formula: C4H10BF3O Molecular Weight (g/mol): 141.93 MDL Number: MFCD00013194 InChI Key: KZMGYPLQYOPHEL-UHFFFAOYSA-N Synonym: Boron trifluoride ethyl ether PubChem CID: 8000 IUPAC Name: ethoxyethane;trifluoroborane SMILES: FB(F)F.CCOCC
| PubChem CID | 8000 |
|---|---|
| CAS | 109-63-7 |
| Molecular Weight (g/mol) | 141.93 |
| MDL Number | MFCD00013194 |
| SMILES | FB(F)F.CCOCC |
| Synonym | Boron trifluoride ethyl ether |
| IUPAC Name | ethoxyethane;trifluoroborane |
| InChI Key | KZMGYPLQYOPHEL-UHFFFAOYSA-N |
| Molecular Formula | C4H10BF3O |
Diisobutylaluminium hydride, 1.2M (20 wt%) solution in toluene, AcroSeal™
CAS: 1191-15-7 | C8H19Al | 142.22 g/mol
| Boiling Point | 110.0°C |
|---|---|
| Linear Formula | [(CH3)2CHCH2]2AIH |
| Molecular Weight (g/mol) | 142.22 |
| Physical Form | Solution |
| Chemical Name or Material | Diisobutylaluminium hydride |
| Merck Index | 15, 3212 |
| Density | 0.8480g/mL |
| Fieser | 01,260; 02,140; 03,101; 04,158; 05,224; 06,198; 07,111; 08,173; 09,171; 10,149; 11,185; 12,191; 13,115; 14,138; 15,137; 16,27; 17,123 |
| CAS | 108-88-3 |
| Health Hazard 3 | GHS P Statement IF SWALLOWED: rinse mouth. Do NOT induce vomiting. Wear eye protection/face protection. IF IN EYES: Rinse cautiously with water for several minutes. Remove contact lenses,if present and easy to do. Continue rinsi |
| MDL Number | MFCD00008928 |
| Health Hazard 2 | GHS H Statement Causes severe skin burns and eye damage. May be fatal if swallowed and enters airways. May cause damage to organs through prolonged or repeated exposure. Suspected of damaging the unborn child. May cause dro |
| Solubility Information | Solubility in water: reacts violently. Other solubilities: miscible with saturated aliphatic and aromatic,hydrocarbons |
| Flash Point | 4°C |
| Health Hazard 1 | GHS Signal Word: Danger |
| Synonym | DIBAL-H |
| Beilstein | 04, IV, 4400 |
| Molecular Formula | C8H19Al |
| EINECS Number | 214-729-9 |
| Formula Weight | 142.22 |
| Specific Gravity | 0.848 |